C22H26N2O5 — CID 67000414
7-[(1R,2R,3R)-2-[3-(1H-benzimidazol-2-yl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 67000414) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[3-(1H-benzimidazol-2-yl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[3-(1H-benzimidazol-2-yl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000414 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[3-(1H-benzimidazol-2-yl)-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1C(=O)C[C@@H](O)[C@@H]1C=CC(O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H26N2O5/c25-18(22-23-16-8-5-6-9-17(16)24-22)12-11-15-14(19(26)13-20(15)27)7-3-1-2-4-10-21(28)29/h1,3,5-6,8-9,11-12,14-15,18,20,25,27H,2,4,7,10,13H2,(H,23,24)(H,28,29)/t14-,15-,18?,20-/m1/s1 |
| InChIKey | SVUBUTGSAAGRBH-JLJZIRLHSA-N |
| XLogP | 2.92 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|