C40H46O4SSi — CID 66999876
7-[(1R,2R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-hydroxy-3-methylidenecyclopentyl]hept-5-enoic acid (PubChem CID 66999876) has the molecular formula C40H46O4SSi and a molecular weight of 650.96 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-hydroxy-3-methylidenecyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-hydroxy-3-methylidenecyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 66999876 |
| Molecular Formula | C40H46O4SSi |
| Molecular Weight | 650.96 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3R)-3-(1-benzothiophen-2-yl)-3-[tert-butyl(diphenyl)silyl]oxyprop-1-enyl]-5-hydroxy-3-methylidenecyclopentyl]hept-5-enoic acid |
| SMILES | C=C1C[C@H](O)[C@H](CC=CCCCC(=O)O)[C@H]1C=C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1cc2ccccc2s1 |
| InChI | InChI=1S/C40H46O4SSi/c1-29-27-35(41)34(22-13-5-6-14-24-39(42)43)33(29)25-26-36(38-28-30-17-15-16-23-37(30)45-38)44-46(40(2,3)4,31-18-9-7-10-19-31)32-20-11-8-12-21-32/h5,7-13,15-21,23,25-26,28,33-36,41H,1,6,14,22,24,27H2,2-4H3,(H,42,43)/t33-,34+,35-,36+/m0/s1 |
| InChIKey | MSSHMDUQFDMVKG-IHUVGRGJSA-N |
| XLogP | 8.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.96 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|