C39H46O5SSi — CID 70670675
(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 70670675) has the molecular formula C39H46O5SSi and a molecular weight of 654.95 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70670675 |
| Molecular Formula | C39H46O5SSi |
| Molecular Weight | 654.95 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-(1-benzothiophen-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)(C[C@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O)c1cc2ccccc2s1)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H46O5SSi/c1-39(2,46(44,30-16-7-5-8-17-30)31-18-9-6-10-19-31)27-29(37-25-28-15-13-14-21-36(28)45-37)23-24-33-32(34(40)26-35(33)41)20-11-3-4-12-22-38(42)43/h3,5-11,13-19,21,23-25,29,32-35,40-41,44H,4,12,20,22,26-27H2,1-2H3,(H,42,43)/b11-3-,24-23+/t29-,32+,33+,34-,35+/m0/s1 |
| InChIKey | CIRLKUZRUWNFIP-IUEBYKNESA-N |
| XLogP | 7.02 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.95 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|