C34H36O4SSi — CID 70670693
(3aR,4R,5R,6aS)-4-[(E,3R)-3-(1-benzothiophen-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 70670693) has the molecular formula C34H36O4SSi and a molecular weight of 568.81 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E,3R)-3-(1-benzothiophen-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E,3R)-3-(1-benzothiophen-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 70670693 |
| Molecular Formula | C34H36O4SSi |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E,3R)-3-(1-benzothiophen-2-yl)-5-[hydroxy(diphenyl)silyl]-5-methylhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C[C@H](/C=C/[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O)c1cc2ccccc2s1)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H36O4SSi/c1-34(2,40(37,25-12-5-3-6-13-25)26-14-7-4-8-15-26)22-24(32-19-23-11-9-10-16-31(23)39-32)17-18-27-28-20-33(36)38-30(28)21-29(27)35/h3-19,24,27-30,35,37H,20-22H2,1-2H3/b18-17+/t24-,27+,28+,29+,30-/m0/s1 |
| InChIKey | VYFAZXYZLFWHNH-BMGSTQSNSA-N |
| XLogP | 5.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|