C19H26O4 — CID 156528164
(3aR,4R,5R,6aS)-4-[(E,3R,4R)-3-hydroxy-4-(3-methylphenyl)pent-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 156528164) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E,3R,4R)-3-hydroxy-4-(3-methylphenyl)pent-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E,3R,4R)-3-hydroxy-4-(3-methylphenyl)pent-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 156528164 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E,3R,4R)-3-hydroxy-4-(3-methylphenyl)pent-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | Cc1cccc([C@@H](C)[C@H](O)/C=C/[C@@H]2[C@H]3CC(O)O[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C19H26O4/c1-11-4-3-5-13(8-11)12(2)16(20)7-6-14-15-9-19(22)23-18(15)10-17(14)21/h3-8,12,14-22H,9-10H2,1-2H3/b7-6+/t12-,14-,15-,16-,17-,18+,19?/m1/s1 |
| InChIKey | OUQPYBQNTTUTOM-VCVPFWPOSA-N |
| XLogP | 2.12 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|