C22H32O3 — CID 58526044
(3aR,4R,5R,6aS)-4-[(E,3S)-4,4-dimethyl-3-(2-phenylethyl)pent-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 58526044) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E,3S)-4,4-dimethyl-3-(2-phenylethyl)pent-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E,3S)-4,4-dimethyl-3-(2-phenylethyl)pent-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 58526044 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E,3S)-4,4-dimethyl-3-(2-phenylethyl)pent-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | CC(C)(C)[C@H](/C=C/[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1O)CCc1ccccc1 |
| InChI | InChI=1S/C22H32O3/c1-22(2,3)16(10-9-15-7-5-4-6-8-15)11-12-17-18-13-21(24)25-20(18)14-19(17)23/h4-8,11-12,16-21,23-24H,9-10,13-14H2,1-3H3/b12-11+/t16-,17+,18+,19+,20-,21?/m0/s1 |
| InChIKey | RKICHQSIHXHQDL-UAXOXYNGSA-N |
| XLogP | 3.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|