C18H22O3S — CID 71011298
(1R,3R,4S)-4-[(E,3R)-3-(1-benzothiophen-2-yl)-3-ethoxyprop-1-enyl]cyclopentane-1,3-diol (PubChem CID 71011298) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is (1R,3R,4S)-4-[(E,3R)-3-(1-benzothiophen-2-yl)-3-ethoxyprop-1-enyl]cyclopentane-1,3-diol.
| Compound Name | (1R,3R,4S)-4-[(E,3R)-3-(1-benzothiophen-2-yl)-3-ethoxyprop-1-enyl]cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 71011298 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (1R,3R,4S)-4-[(E,3R)-3-(1-benzothiophen-2-yl)-3-ethoxyprop-1-enyl]cyclopentane-1,3-diol |
| SMILES | CCO[C@H](/C=C/[C@@H]1C[C@@H](O)C[C@H]1O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C18H22O3S/c1-2-21-16(8-7-12-9-14(19)11-15(12)20)18-10-13-5-3-4-6-17(13)22-18/h3-8,10,12,14-16,19-20H,2,9,11H2,1H3/b8-7+/t12-,14-,15-,16-/m1/s1 |
| InChIKey | ILVZEPWLNKOQAH-CRTPXEHMSA-N |
| XLogP | 3.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|