C26H33NO4S — CID 66764244
7-[(5R)-5-[4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enamide (PubChem CID 66764244) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is 7-[(5R)-5-[4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enamide.
| Compound Name | 7-[(5R)-5-[4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 66764244 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 7-[(5R)-5-[4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-enamide |
| SMILES | CC1(C)C(=O)C(CC=CCCCC(N)=O)[C@@H](C=CC(O)Cc2cc3ccccc3s2)C1O |
| InChI | InChI=1S/C26H33NO4S/c1-26(2)24(30)20(10-5-3-4-6-12-23(27)29)21(25(26)31)14-13-18(28)16-19-15-17-9-7-8-11-22(17)32-19/h3,5,7-9,11,13-15,18,20-21,25,28,31H,4,6,10,12,16H2,1-2H3,(H2,27,29)/t18?,20?,21-,25?/m1/s1 |
| InChIKey | CSTSKQGOLRXWSB-NWJSLLFKSA-N |
| XLogP | 4.16 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|