C26H30O5S — CID 67311693
7-[(1R,4S,5R)-5-[4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoic acid (PubChem CID 67311693) has the molecular formula C26H30O5S and a molecular weight of 454.59 g/mol. Its IUPAC name is 7-[(1R,4S,5R)-5-[4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoic acid.
| Compound Name | 7-[(1R,4S,5R)-5-[4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 67311693 |
| Molecular Formula | C26H30O5S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 7-[(1R,4S,5R)-5-[4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoic acid |
| SMILES | CC1(C)C(=O)[C@H](CC#CCCCC(=O)O)[C@@H](C=CC(O)Cc2cc3ccccc3s2)[C@@H]1O |
| InChI | InChI=1S/C26H30O5S/c1-26(2)24(30)20(10-5-3-4-6-12-23(28)29)21(25(26)31)14-13-18(27)16-19-15-17-9-7-8-11-22(17)32-19/h7-9,11,13-15,18,20-21,25,27,31H,4,6,10,12,16H2,1-2H3,(H,28,29)/t18?,20-,21-,25+/m1/s1 |
| InChIKey | MNSSULPKPIROKW-UTVMIKHCSA-N |
| XLogP | 4.21 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|