C12H12O2S — CID 117119996
3-(1-benzothiophen-2-yl)-2-methylpropanoic acid (PubChem CID 117119996) has the molecular formula C12H12O2S and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-2-methylpropanoic acid.
| Compound Name | 3-(1-benzothiophen-2-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117119996 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-2-methylpropanoic acid |
| SMILES | CC(Cc1cc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C12H12O2S/c1-8(12(13)14)6-10-7-9-4-2-3-5-11(9)15-10/h2-5,7-8H,6H2,1H3,(H,13,14) |
| InChIKey | UHGWMZOOYHXBQT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |