C19H25NO4S — CID 77397308
propan-2-yl 3-(1-benzothiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 77397308) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is propan-2-yl 3-(1-benzothiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | propan-2-yl 3-(1-benzothiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 77397308 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | propan-2-yl 3-(1-benzothiophen-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)OC(=O)C(Cc1cc2ccccc2s1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H25NO4S/c1-12(2)23-17(21)15(20-18(22)24-19(3,4)5)11-14-10-13-8-6-7-9-16(13)25-14/h6-10,12,15H,11H2,1-5H3,(H,20,22) |
| InChIKey | GNDKQBIHXHOOKQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |