C20H26O4S — CID 158692815
4-O-tert-butyl 1-O-propan-2-yl (2R)-2-(1-benzothiophen-2-ylmethyl)butanedioate (PubChem CID 158692815) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-propan-2-yl (2R)-2-(1-benzothiophen-2-ylmethyl)butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-propan-2-yl (2R)-2-(1-benzothiophen-2-ylmethyl)butanedioate |
|---|---|
| PubChem CID | 158692815 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-O-tert-butyl 1-O-propan-2-yl (2R)-2-(1-benzothiophen-2-ylmethyl)butanedioate |
| SMILES | CC(C)OC(=O)[C@H](CC(=O)OC(C)(C)C)Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C20H26O4S/c1-13(2)23-19(22)15(12-18(21)24-20(3,4)5)11-16-10-14-8-6-7-9-17(14)25-16/h6-10,13,15H,11-12H2,1-5H3/t15-/m0/s1 |
| InChIKey | IGOJKPZBFLYDRX-HNNXBMFYSA-N |
| XLogP | 4.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |