C16H19NO4S — CID 91015241
1-benzothiophen-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 91015241) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-benzothiophen-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | 1-benzothiophen-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 91015241 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1-benzothiophen-2-yl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)Oc1cc2ccccc2s1 |
| InChI | InChI=1S/C16H19NO4S/c1-10(17-15(19)21-16(2,3)4)14(18)20-13-9-11-7-5-6-8-12(11)22-13/h5-10H,1-4H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | SFIVRAKPVGDKRL-JTQLQIEISA-N |
| XLogP | 3.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |