C15H22N2O5 — CID 146315153
(5-amino-2-methoxyphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 146315153) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (5-amino-2-methoxyphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (5-amino-2-methoxyphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 146315153 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (5-amino-2-methoxyphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COc1ccc(N)cc1OC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N2O5/c1-9(17-14(19)22-15(2,3)4)13(18)21-12-8-10(16)6-7-11(12)20-5/h6-9H,16H2,1-5H3,(H,17,19)/t9-/m0/s1 |
| InChIKey | ZQEBAJYSDMNLOU-VIFPVBQESA-N |
| XLogP | 2.10 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|