C15H21BrN2O5 — CID 175427297
(3-amino-2-bromo-6-methoxyphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 175427297) has the molecular formula C15H21BrN2O5 and a molecular weight of 389.25 g/mol. Its IUPAC name is (3-amino-2-bromo-6-methoxyphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | (3-amino-2-bromo-6-methoxyphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 175427297 |
| Molecular Formula | C15H21BrN2O5 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | (3-amino-2-bromo-6-methoxyphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COc1ccc(N)c(Br)c1OC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21BrN2O5/c1-8(18-14(20)23-15(2,3)4)13(19)22-12-10(21-5)7-6-9(17)11(12)16/h6-8H,17H2,1-5H3,(H,18,20)/t8-/m0/s1 |
| InChIKey | UDXKNWBOYRRZDQ-QMMMGPOBSA-N |
| XLogP | 2.86 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|