C26H31NO5S — CID 58252437
amino 7-[(1R,4S,5R)-5-[(E)-4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoate (PubChem CID 58252437) has the molecular formula C26H31NO5S and a molecular weight of 469.60 g/mol. Its IUPAC name is amino 7-[(1R,4S,5R)-5-[(E)-4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoate.
| Compound Name | amino 7-[(1R,4S,5R)-5-[(E)-4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoate |
|---|---|
| PubChem CID | 58252437 |
| Molecular Formula | C26H31NO5S |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | amino 7-[(1R,4S,5R)-5-[(E)-4-(1-benzothiophen-2-yl)-3-hydroxybut-1-enyl]-4-hydroxy-3,3-dimethyl-2-oxocyclopentyl]hept-5-ynoate |
| SMILES | CC1(C)C(=O)[C@H](CC#CCCCC(=O)ON)[C@@H](/C=C/C(O)Cc2cc3ccccc3s2)[C@@H]1O |
| InChI | InChI=1S/C26H31NO5S/c1-26(2)24(30)20(10-5-3-4-6-12-23(29)32-27)21(25(26)31)14-13-18(28)16-19-15-17-9-7-8-11-22(17)33-19/h7-9,11,13-15,18,20-21,25,28,31H,4,6,10,12,16,27H2,1-2H3/b14-13+/t18?,20-,21-,25+/m1/s1 |
| InChIKey | DMCKSVUICLSOMC-ZNVAMYPYSA-N |
| XLogP | 3.54 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|