C27H36O5 — CID 67000922
7-[(1R,2R,5S)-2-[6-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyhex-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 67000922) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[6-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyhex-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[6-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyhex-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67000922 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[6-(2,3-dihydro-1H-inden-2-yl)-3-hydroxyhex-1-enyl]-5-hydroxy-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1[C@@H](O)CC(=O)[C@@H]1C=CC(O)CCCC1Cc2ccccc2C1 |
| InChI | InChI=1S/C27H36O5/c28-22(11-7-8-19-16-20-9-5-6-10-21(20)17-19)14-15-24-23(25(29)18-26(24)30)12-3-1-2-4-13-27(31)32/h1,3,5-6,9-10,14-15,19,22-25,28-29H,2,4,7-8,11-13,16-18H2,(H,31,32)/t22?,23-,24-,25+/m1/s1 |
| InChIKey | QAZMWJRCTJEJFV-PMENIEFESA-N |
| XLogP | 4.26 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|