C24H46O3Si2 — CID 11048429
(4S,5S,6aS)-3-butyl-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 11048429) has the molecular formula C24H46O3Si2 and a molecular weight of 438.80 g/mol. Its IUPAC name is (4S,5S,6aS)-3-butyl-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | (4S,5S,6aS)-3-butyl-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 11048429 |
| Molecular Formula | C24H46O3Si2 |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (4S,5S,6aS)-3-butyl-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CCCCC1=C2[C@H](CC1=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O3Si2/c1-12-13-14-18-19(25)15-17-16-20(26-28(8,9)23(2,3)4)22(21(17)18)27-29(10,11)24(5,6)7/h17,20,22H,12-16H2,1-11H3/t17-,20+,22-/m1/s1 |
| InChIKey | BTAJQAIKJFJJHW-PIPMEXSNSA-N |
| XLogP | 7.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|