C23H46GeO3Si2 — CID 11191226
(4R,5R,6aR)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-trimethylgermyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 11191226) has the molecular formula C23H46GeO3Si2 and a molecular weight of 499.40 g/mol. Its IUPAC name is (4R,5R,6aR)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-trimethylgermyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | (4R,5R,6aR)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-trimethylgermyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 11191226 |
| Molecular Formula | C23H46GeO3Si2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (4R,5R,6aR)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-trimethylgermyl-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C2=C([Ge](C)(C)C)C(=O)C[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46GeO3Si2/c1-22(2,3)28(10,11)26-18-15-16-14-17(25)20(24(7,8)9)19(16)21(18)27-29(12,13)23(4,5)6/h16,18,21H,14-15H2,1-13H3/t16-,18+,21-/m0/s1 |
| InChIKey | ZQTWSICWJRBRAR-CDXJDZJCSA-N |
| XLogP | 6.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|