C20H30N2O6Si — CID 86682539
[(5R,7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]octan-7-yl] acetate (PubChem CID 86682539) has the molecular formula C20H30N2O6Si and a molecular weight of 422.55 g/mol. Its IUPAC name is [(5R,7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]octan-7-yl] acetate.
| Compound Name | [(5R,7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]octan-7-yl] acetate |
|---|---|
| PubChem CID | 86682539 |
| Molecular Formula | C20H30N2O6Si |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(5R,7R,8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-(3-nitro-4-pyridinyl)-4-oxaspiro[2.5]octan-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](c2ccncc2[N+](=O)[O-])OC2(CC2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H30N2O6Si/c1-13(23)26-17-11-16(14-7-10-21-12-15(14)22(24)25)27-20(8-9-20)18(17)28-29(5,6)19(2,3)4/h7,10,12,16-18H,8-9,11H2,1-6H3/t16-,17-,18+/m1/s1 |
| InChIKey | WAGMKXRAKBHPCM-KURKYZTESA-N |
| XLogP | 4.31 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|