C28H46N2O8Si3 — CID 69241802
(4R,7S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,5-dihydroxy-2,6-dioxo-1-phenylmethoxy-7,9-bis(trimethylsilyloxy)-1-azaspiro[3.5]nonane-7-carbonitrile (PubChem CID 69241802) has the molecular formula C28H46N2O8Si3 and a molecular weight of 622.94 g/mol. Its IUPAC name is (4R,7S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,5-dihydroxy-2,6-dioxo-1-phenylmethoxy-7,9-bis(trimethylsilyloxy)-1-azaspiro[3.5]nonane-7-carbonitrile.
| Compound Name | (4R,7S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,5-dihydroxy-2,6-dioxo-1-phenylmethoxy-7,9-bis(trimethylsilyloxy)-1-azaspiro[3.5]nonane-7-carbonitrile |
|---|---|
| PubChem CID | 69241802 |
| Molecular Formula | C28H46N2O8Si3 |
| Molecular Weight | 622.94 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | (4R,7S,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,5-dihydroxy-2,6-dioxo-1-phenylmethoxy-7,9-bis(trimethylsilyloxy)-1-azaspiro[3.5]nonane-7-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@]2(CC(=O)N2OCc2ccccc2)C(O)(O)C(=O)[C@@]1(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C28H46N2O8Si3/c1-25(2,3)41(10,11)37-22-23(36-39(4,5)6)27(17-21(31)30(27)35-18-20-15-13-12-14-16-20)28(33,34)24(32)26(22,19-29)38-40(7,8)9/h12-16,22-23,33-34H,17-18H2,1-11H3/t22-,23+,26-,27+/m0/s1 |
| InChIKey | VGZHZWRGIGAQAL-AYFYORAVSA-N |
| XLogP | 4.08 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|