C28H48N2O7Si3 — CID 58668363
(4R,5S,6S,7R,8R,9S)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dihydroxy-2-oxo-1-phenylmethoxy-5,8-bis(trimethylsilyloxy)-1-azaspiro[3.5]nonane-7-carbonitrile (PubChem CID 58668363) has the molecular formula C28H48N2O7Si3 and a molecular weight of 608.96 g/mol. Its IUPAC name is (4R,5S,6S,7R,8R,9S)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dihydroxy-2-oxo-1-phenylmethoxy-5,8-bis(trimethylsilyloxy)-1-azaspiro[3.5]nonane-7-carbonitrile.
| Compound Name | (4R,5S,6S,7R,8R,9S)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dihydroxy-2-oxo-1-phenylmethoxy-5,8-bis(trimethylsilyloxy)-1-azaspiro[3.5]nonane-7-carbonitrile |
|---|---|
| PubChem CID | 58668363 |
| Molecular Formula | C28H48N2O7Si3 |
| Molecular Weight | 608.96 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | (4R,5S,6S,7R,8R,9S)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dihydroxy-2-oxo-1-phenylmethoxy-5,8-bis(trimethylsilyloxy)-1-azaspiro[3.5]nonane-7-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@@]2(CC(=O)N2OCc2ccccc2)[C@H](O)[C@@H](O[Si](C)(C)C)[C@]1(O)C#N |
| InChI | InChI=1S/C28H48N2O7Si3/c1-26(2,3)40(10,11)37-25-24(36-39(7,8)9)27(22(32)23(28(25,33)19-29)35-38(4,5)6)17-21(31)30(27)34-18-20-15-13-12-14-16-20/h12-16,22-25,32-33H,17-18H2,1-11H3/t22-,23-,24-,25+,27-,28-/m1/s1 |
| InChIKey | KNGVFJVRYPVHIG-ZXTBQGJSSA-N |
| XLogP | 4.55 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.96 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|