C25H43NO5Si2 — CID 10577122
(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-phenylmethoxyoxolane-3-carbonitrile (PubChem CID 10577122) has the molecular formula C25H43NO5Si2 and a molecular weight of 493.79 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-phenylmethoxyoxolane-3-carbonitrile.
| Compound Name | (2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-phenylmethoxyoxolane-3-carbonitrile |
|---|---|
| PubChem CID | 10577122 |
| Molecular Formula | C25H43NO5Si2 |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | (2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-phenylmethoxyoxolane-3-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](OCc2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(O)C#N |
| InChI | InChI=1S/C25H43NO5Si2/c1-23(2,3)32(7,8)29-17-20-25(27,18-26)21(31-33(9,10)24(4,5)6)22(30-20)28-16-19-14-12-11-13-15-19/h11-15,20-22,27H,16-17H2,1-10H3/t20-,21+,22-,25-/m1/s1 |
| InChIKey | PCOXYMRYLMZQQI-WTEVXDJOSA-N |
| XLogP | 5.59 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|