C17H26N2O7Si — CID 10668565
1-[(2R,3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-5-oxo-3,4,7,7a-tetrahydro-2H-furo[2,3-c]pyran-2-yl]pyrimidine-2,4-dione (PubChem CID 10668565) has the molecular formula C17H26N2O7Si and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-[(2R,3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-5-oxo-3,4,7,7a-tetrahydro-2H-furo[2,3-c]pyran-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-5-oxo-3,4,7,7a-tetrahydro-2H-furo[2,3-c]pyran-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10668565 |
| Molecular Formula | C17H26N2O7Si |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-[(2R,3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-5-oxo-3,4,7,7a-tetrahydro-2H-furo[2,3-c]pyran-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]2COC(=O)C[C@@]21O |
| InChI | InChI=1S/C17H26N2O7Si/c1-16(2,3)27(4,5)26-13-14(19-7-6-11(20)18-15(19)22)25-10-9-24-12(21)8-17(10,13)23/h6-7,10,13-14,23H,8-9H2,1-5H3,(H,18,20,22)/t10-,13+,14-,17-/m1/s1 |
| InChIKey | HYZKIGLYGRFVBM-KEAXFYSCSA-N |
| XLogP | 0.50 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|