C17H26O6Si — CID 169299268
(3S,4R,5R)-3-hydroxy-4-[(4-methoxyphenyl)methoxy]-3-methyl-5-(trimethylsilyloxymethyl)oxolan-2-one (PubChem CID 169299268) has the molecular formula C17H26O6Si and a molecular weight of 354.48 g/mol. Its IUPAC name is (3S,4R,5R)-3-hydroxy-4-[(4-methoxyphenyl)methoxy]-3-methyl-5-(trimethylsilyloxymethyl)oxolan-2-one.
| Compound Name | (3S,4R,5R)-3-hydroxy-4-[(4-methoxyphenyl)methoxy]-3-methyl-5-(trimethylsilyloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 169299268 |
| Molecular Formula | C17H26O6Si |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (3S,4R,5R)-3-hydroxy-4-[(4-methoxyphenyl)methoxy]-3-methyl-5-(trimethylsilyloxymethyl)oxolan-2-one |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](CO[Si](C)(C)C)OC(=O)[C@@]2(C)O)cc1 |
| InChI | InChI=1S/C17H26O6Si/c1-17(19)15(14(23-16(17)18)11-22-24(3,4)5)21-10-12-6-8-13(20-2)9-7-12/h6-9,14-15,19H,10-11H2,1-5H3/t14-,15-,17+/m1/s1 |
| InChIKey | UEUHQCMPXXMSAK-INMHGKMJSA-N |
| XLogP | 2.11 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|