C16H20O5 — CID 134352834
(3R,4S,5R)-3-ethenyl-4-hydroxy-5-[(4-methoxyphenyl)methoxymethyl]-3-methyloxolan-2-one (PubChem CID 134352834) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (3R,4S,5R)-3-ethenyl-4-hydroxy-5-[(4-methoxyphenyl)methoxymethyl]-3-methyloxolan-2-one.
| Compound Name | (3R,4S,5R)-3-ethenyl-4-hydroxy-5-[(4-methoxyphenyl)methoxymethyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 134352834 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (3R,4S,5R)-3-ethenyl-4-hydroxy-5-[(4-methoxyphenyl)methoxymethyl]-3-methyloxolan-2-one |
| SMILES | C=C[C@@]1(C)C(=O)O[C@H](COCc2ccc(OC)cc2)[C@H]1O |
| InChI | InChI=1S/C16H20O5/c1-4-16(2)14(17)13(21-15(16)18)10-20-9-11-5-7-12(19-3)8-6-11/h4-8,13-14,17H,1,9-10H2,2-3H3/t13-,14-,16-/m1/s1 |
| InChIKey | SUWVIPQVMIZJSH-IIAWOOMASA-N |
| XLogP | 1.69 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|