C18H22N2O6S — CID 101145891
(3aR,4R,6R,6aR)-6-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-2'-sulfanylidenespiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,5'-imidazolidine]-4'-one (PubChem CID 101145891) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is (3aR,4R,6R,6aR)-6-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-2'-sulfanylidenespiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,5'-imidazolidine]-4'-one.
| Compound Name | (3aR,4R,6R,6aR)-6-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-2'-sulfanylidenespiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 101145891 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (3aR,4R,6R,6aR)-6-[(4-methoxyphenyl)methoxymethyl]-2,2-dimethyl-2'-sulfanylidenespiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,5'-imidazolidine]-4'-one |
| SMILES | COc1ccc(COC[C@H]2O[C@]3(NC(=S)NC3=O)[C@@H]3OC(C)(C)O[C@@H]32)cc1 |
| InChI | InChI=1S/C18H22N2O6S/c1-17(2)25-13-12(9-23-8-10-4-6-11(22-3)7-5-10)24-18(14(13)26-17)15(21)19-16(27)20-18/h4-7,12-14H,8-9H2,1-3H3,(H2,19,20,21,27)/t12-,13-,14-,18-/m1/s1 |
| InChIKey | WFVZFGNTLQERNM-UHQDVWGKSA-N |
| XLogP | 0.83 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|