About 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene
1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene (PubChem CID 101026264) has the molecular formula C16H20Cl2O2
and a molecular weight of 315.24 g/mol. Its IUPAC name is 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene.
Molecular Properties
| Compound Name | 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene |
| PubChem CID | 101026264 |
| Molecular Formula | C16H20Cl2O2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene |
| SMILES | COc1ccc(COCC2C(C=C(Cl)Cl)C2(C)C)cc1 |
| InChI | InChI=1S/C16H20Cl2O2/c1-16(2)13(8-15(17)18)14(16)10-20-9-11-4-6-12(19-3)7-5-11/h4-8,13-14H,9-10H2,1-3H3 |
| InChIKey | UYLUVEXDAPVGEF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene?
The IUPAC name of 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene (CID 101026264) is 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene.
What is the SMILES notation for 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene?
The canonical SMILES for 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene is COc1ccc(COCC2C(C=C(Cl)Cl)C2(C)C)cc1.
What is the InChIKey of 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene?
The InChIKey is UYLUVEXDAPVGEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2O2/c1-16(2)13(8-15(17)18)14(16)10-20-9-11-4-6-12(19-3)7-5-11/h4-8,13-14H,9-10H2,1-3H3.
What are the key properties of 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene?
1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene has a molecular weight of 315.24 g/mol, XLogP of 4.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropyl]methoxymethyl]-4-methoxybenzene is sourced from PubChem (CID 101026264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).