About 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene
1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene (PubChem CID 141021415) has the molecular formula C18H26O
and a molecular weight of 258.40 g/mol. Its IUPAC name is 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene.
Molecular Properties
| Compound Name | 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene |
| PubChem CID | 141021415 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene |
| SMILES | COCc1ccc(CC2C(C=C(C)C)C2(C)C)cc1 |
| InChI | InChI=1S/C18H26O/c1-13(2)10-16-17(18(16,3)4)11-14-6-8-15(9-7-14)12-19-5/h6-10,16-17H,11-12H2,1-5H3 |
| InChIKey | VDCGNHRNJVVMJG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene?
The IUPAC name of 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene (CID 141021415) is 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene.
What is the SMILES notation for 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene?
The canonical SMILES for 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene is COCc1ccc(CC2C(C=C(C)C)C2(C)C)cc1.
What is the InChIKey of 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene?
The InChIKey is VDCGNHRNJVVMJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O/c1-13(2)10-16-17(18(16,3)4)11-14-6-8-15(9-7-14)12-19-5/h6-10,16-17H,11-12H2,1-5H3.
What are the key properties of 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene?
1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene has a molecular weight of 258.40 g/mol, XLogP of 4.61, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropyl]methyl]-4-(methoxymethyl)benzene is sourced from PubChem (CID 141021415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).