C23H34N2O5Si — CID 139966575
[(2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxyoxan-4-yl] imidazole-1-carboxylate (PubChem CID 139966575) has the molecular formula C23H34N2O5Si and a molecular weight of 446.62 g/mol. Its IUPAC name is [(2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxyoxan-4-yl] imidazole-1-carboxylate.
| Compound Name | [(2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxyoxan-4-yl] imidazole-1-carboxylate |
|---|---|
| PubChem CID | 139966575 |
| Molecular Formula | C23H34N2O5Si |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | [(2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxyoxan-4-yl] imidazole-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OCC[C@@H](OC(=O)n2ccnc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H34N2O5Si/c1-23(2,3)31(4,5)29-16-20-21(28-15-18-9-7-6-8-10-18)19(11-14-27-20)30-22(26)25-13-12-24-17-25/h6-10,12-13,17,19-21H,11,14-16H2,1-5H3/t19-,20-,21+/m1/s1 |
| InChIKey | HZWKJKYPLBDQAZ-NJYVYQBISA-N |
| XLogP | 4.63 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|