C21H33NO5Si — CID 141251927
benzyl [2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]-2-oxoethyl] carbonate (PubChem CID 141251927) has the molecular formula C21H33NO5Si and a molecular weight of 407.58 g/mol. Its IUPAC name is benzyl [2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]-2-oxoethyl] carbonate.
| Compound Name | benzyl [2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]-2-oxoethyl] carbonate |
|---|---|
| PubChem CID | 141251927 |
| Molecular Formula | C21H33NO5Si |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | benzyl [2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]-2-oxoethyl] carbonate |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CC(C(=O)COC(=O)OCc2ccccc2)CN1 |
| InChI | InChI=1S/C21H33NO5Si/c1-21(2,3)28(4,5)27-14-18-11-17(12-22-18)19(23)15-26-20(24)25-13-16-9-7-6-8-10-16/h6-10,17-18,22H,11-15H2,1-5H3 |
| InChIKey | AWJDKVPYSVVKTJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|