C25H38N2OSi — CID 151840020
(3S,5S)-N,N-dibenzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-amine (PubChem CID 151840020) has the molecular formula C25H38N2OSi and a molecular weight of 410.68 g/mol. Its IUPAC name is (3S,5S)-N,N-dibenzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-amine.
| Compound Name | (3S,5S)-N,N-dibenzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 151840020 |
| Molecular Formula | C25H38N2OSi |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (3S,5S)-N,N-dibenzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@H](N(Cc2ccccc2)Cc2ccccc2)CN1 |
| InChI | InChI=1S/C25H38N2OSi/c1-25(2,3)29(4,5)28-20-23-16-24(17-26-23)27(18-21-12-8-6-9-13-21)19-22-14-10-7-11-15-22/h6-15,23-24,26H,16-20H2,1-5H3/t23-,24-/m0/s1 |
| InChIKey | SGLORAVTMKMUDV-ZEQRLZLVSA-N |
| XLogP | 5.44 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|