C19H34N2O2Si — CID 142734457
(6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-phenylmethoxypiperidin-3-amine (PubChem CID 142734457) has the molecular formula C19H34N2O2Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-phenylmethoxypiperidin-3-amine.
| Compound Name | (6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-phenylmethoxypiperidin-3-amine |
|---|---|
| PubChem CID | 142734457 |
| Molecular Formula | C19H34N2O2Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-phenylmethoxypiperidin-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC(NOCc2ccccc2)CN1 |
| InChI | InChI=1S/C19H34N2O2Si/c1-19(2,3)24(4,5)23-15-18-12-11-17(13-20-18)21-22-14-16-9-7-6-8-10-16/h6-10,17-18,20-21H,11-15H2,1-5H3/t17?,18-/m0/s1 |
| InChIKey | NUGPVXNEUMEHIK-ZVAWYAOSSA-N |
| XLogP | 3.85 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|