C11H24FNOSi — CID 167468877
tert-butyl-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methoxy]-dimethylsilane (PubChem CID 167468877) has the molecular formula C11H24FNOSi and a molecular weight of 233.40 g/mol. Its IUPAC name is tert-butyl-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 167468877 |
| Molecular Formula | C11H24FNOSi |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | tert-butyl-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@H](F)CN1 |
| InChI | InChI=1S/C11H24FNOSi/c1-11(2,3)15(4,5)14-8-10-6-9(12)7-13-10/h9-10,13H,6-8H2,1-5H3/t9-,10-/m0/s1 |
| InChIKey | IOSOTWZAVMYLBQ-UWVGGRQHSA-N |
| XLogP | 2.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|