C11H23NOSi — CID 67131023
tert-butyl-(2,3-dihydro-1H-pyrrol-3-ylmethoxy)-dimethylsilane (PubChem CID 67131023) has the molecular formula C11H23NOSi and a molecular weight of 213.40 g/mol. Its IUPAC name is tert-butyl-(2,3-dihydro-1H-pyrrol-3-ylmethoxy)-dimethylsilane.
| Compound Name | tert-butyl-(2,3-dihydro-1H-pyrrol-3-ylmethoxy)-dimethylsilane |
|---|---|
| PubChem CID | 67131023 |
| Molecular Formula | C11H23NOSi |
| Molecular Weight | 213.40 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | tert-butyl-(2,3-dihydro-1H-pyrrol-3-ylmethoxy)-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1C=CNC1 |
| InChI | InChI=1S/C11H23NOSi/c1-11(2,3)14(4,5)13-9-10-6-7-12-8-10/h6-7,10,12H,8-9H2,1-5H3 |
| InChIKey | MGHHRSRRLSBKQE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|