C22H33NO3Si — CID 11531177
tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenylpyrrole-1-carboxylate (PubChem CID 11531177) has the molecular formula C22H33NO3Si and a molecular weight of 387.60 g/mol. Its IUPAC name is tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenylpyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 11531177 |
| Molecular Formula | C22H33NO3Si |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenylpyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(CO[Si](C)(C)C(C)(C)C)ccc1-c1ccccc1 |
| InChI | InChI=1S/C22H33NO3Si/c1-21(2,3)26-20(24)23-18(16-25-27(7,8)22(4,5)6)14-15-19(23)17-12-10-9-11-13-17/h9-15H,16H2,1-8H3 |
| InChIKey | BJXJMVJRZQVILR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|