C19H34N2O5Si — CID 91161411
tert-butyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-ethoxy-2-oxoethyl)pyrazole-1-carboxylate (PubChem CID 91161411) has the molecular formula C19H34N2O5Si and a molecular weight of 398.58 g/mol. Its IUPAC name is tert-butyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-ethoxy-2-oxoethyl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-ethoxy-2-oxoethyl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 91161411 |
| Molecular Formula | C19H34N2O5Si |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | tert-butyl 5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(2-ethoxy-2-oxoethyl)pyrazole-1-carboxylate |
| SMILES | CCOC(=O)Cc1cc(CO[Si](C)(C)C(C)(C)C)n(C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C19H34N2O5Si/c1-10-24-16(22)12-14-11-15(13-25-27(8,9)19(5,6)7)21(20-14)17(23)26-18(2,3)4/h11H,10,12-13H2,1-9H3 |
| InChIKey | NQOXEQMNXUWSOR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|