C28H57N3O7Si2 — CID 174021807
tert-butyl N-[2-[2-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]carbamate (PubChem CID 174021807) has the molecular formula C28H57N3O7Si2 and a molecular weight of 603.95 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]carbamate |
|---|---|
| PubChem CID | 174021807 |
| Molecular Formula | C28H57N3O7Si2 |
| Molecular Weight | 603.95 g/mol |
| Exact Mass | 603.37 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOCCOCCOCCn1nc(CO[Si](C)(C)C(C)(C)C)cc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H57N3O7Si2/c1-26(2,3)38-25(32)30-35-19-18-34-17-16-33-15-14-31-24(22-37-40(12,13)28(7,8)9)20-23(29-31)21-36-39(10,11)27(4,5)6/h20H,14-19,21-22H2,1-13H3,(H,30,32) |
| InChIKey | KTGVHHVFLUVXLX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.95 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|