C22H39NO5Si — CID 147259528
tert-butyl N-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethyl)phenoxy]ethyl]carbamate (PubChem CID 147259528) has the molecular formula C22H39NO5Si and a molecular weight of 425.64 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethyl)phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethyl)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 147259528 |
| Molecular Formula | C22H39NO5Si |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | tert-butyl N-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(methoxymethyl)phenoxy]ethyl]carbamate |
| SMILES | COCc1cc(CO[Si](C)(C)C(C)(C)C)cc(OCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H39NO5Si/c1-21(2,3)28-20(24)23-10-11-26-19-13-17(15-25-7)12-18(14-19)16-27-29(8,9)22(4,5)6/h12-14H,10-11,15-16H2,1-9H3,(H,23,24) |
| InChIKey | COHCLSGMJLHZMC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|