C41H33NO2 — CID 102110847
tert-butyl 2,5-bis(4-naphthalen-2-ylphenyl)pyrrole-1-carboxylate (PubChem CID 102110847) has the molecular formula C41H33NO2 and a molecular weight of 571.72 g/mol. Its IUPAC name is tert-butyl 2,5-bis(4-naphthalen-2-ylphenyl)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2,5-bis(4-naphthalen-2-ylphenyl)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 102110847 |
| Molecular Formula | C41H33NO2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | tert-butyl 2,5-bis(4-naphthalen-2-ylphenyl)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2ccc(-c3ccc4ccccc4c3)cc2)ccc1-c1ccc(-c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C41H33NO2/c1-41(2,3)44-40(43)42-38(32-18-12-30(13-19-32)36-22-16-28-8-4-6-10-34(28)26-36)24-25-39(42)33-20-14-31(15-21-33)37-23-17-29-9-5-7-11-35(29)27-37/h4-27H,1-3H3 |
| InChIKey | FMOAEMQLJNRWBZ-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |