C25H33NO2Si2 — CID 44552230
tert-butyl 2,5-bis[dimethyl(phenyl)silyl]pyrrole-1-carboxylate (PubChem CID 44552230) has the molecular formula C25H33NO2Si2 and a molecular weight of 435.72 g/mol. Its IUPAC name is tert-butyl 2,5-bis[dimethyl(phenyl)silyl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2,5-bis[dimethyl(phenyl)silyl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 44552230 |
| Molecular Formula | C25H33NO2Si2 |
| Molecular Weight | 435.72 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | tert-butyl 2,5-bis[dimethyl(phenyl)silyl]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c([Si](C)(C)c2ccccc2)ccc1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H33NO2Si2/c1-25(2,3)28-24(27)26-22(29(4,5)20-14-10-8-11-15-20)18-19-23(26)30(6,7)21-16-12-9-13-17-21/h8-19H,1-7H3 |
| InChIKey | UIAQISSUFQMMAW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.72 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|