C33H31N3O2 — CID 139840287
tert-butyl 2,5-bis(N-phenylanilino)pyrrole-1-carboxylate (PubChem CID 139840287) has the molecular formula C33H31N3O2 and a molecular weight of 501.63 g/mol. Its IUPAC name is tert-butyl 2,5-bis(N-phenylanilino)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2,5-bis(N-phenylanilino)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 139840287 |
| Molecular Formula | C33H31N3O2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | tert-butyl 2,5-bis(N-phenylanilino)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(N(c2ccccc2)c2ccccc2)ccc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H31N3O2/c1-33(2,3)38-32(37)36-30(34(26-16-8-4-9-17-26)27-18-10-5-11-19-27)24-25-31(36)35(28-20-12-6-13-21-28)29-22-14-7-15-23-29/h4-25H,1-3H3 |
| InChIKey | KFINFGQZMFWUDE-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |