C15H29NO2Sn2 — CID 15169099
tert-butyl 2,5-bis(trimethylstannyl)pyrrole-1-carboxylate (PubChem CID 15169099) has the molecular formula C15H29NO2Sn2 and a molecular weight of 492.82 g/mol. Its IUPAC name is tert-butyl 2,5-bis(trimethylstannyl)pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2,5-bis(trimethylstannyl)pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 15169099 |
| Molecular Formula | C15H29NO2Sn2 |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | tert-butyl 2,5-bis(trimethylstannyl)pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c([Sn](C)(C)C)ccc1[Sn](C)(C)C |
| InChI | InChI=1S/C9H11NO2.6CH3.2Sn/c1-9(2,3)12-8(11)10-6-4-5-7-10;;;;;;;;/h4-5H,1-3H3;6*1H3;; |
| InChIKey | WJMWNWIAMRXQSH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |