C10H13Cl2NO2 — CID 139840186
tert-butyl 2,5-dichloro-3-methylpyrrole-1-carboxylate (PubChem CID 139840186) has the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. Its IUPAC name is tert-butyl 2,5-dichloro-3-methylpyrrole-1-carboxylate.
| Compound Name | tert-butyl 2,5-dichloro-3-methylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 139840186 |
| Molecular Formula | C10H13Cl2NO2 |
| Molecular Weight | 250.12 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | tert-butyl 2,5-dichloro-3-methylpyrrole-1-carboxylate |
| SMILES | Cc1cc(Cl)n(C(=O)OC(C)(C)C)c1Cl |
| InChI | InChI=1S/C10H13Cl2NO2/c1-6-5-7(11)13(8(6)12)9(14)15-10(2,3)4/h5H,1-4H3 |
| InChIKey | OGTGDAVMBGTSHI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.12 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |