C17H24BNO4 — CID 174084344
[4,5,6,7-tetramethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (PubChem CID 174084344) has the molecular formula C17H24BNO4 and a molecular weight of 317.19 g/mol. Its IUPAC name is [4,5,6,7-tetramethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid.
| Compound Name | [4,5,6,7-tetramethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
|---|---|
| PubChem CID | 174084344 |
| Molecular Formula | C17H24BNO4 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [4,5,6,7-tetramethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| SMILES | Cc1c(C)c(C)c2c(cc(B(O)O)n2C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C17H24BNO4/c1-9-10(2)12(4)15-13(11(9)3)8-14(18(21)22)19(15)16(20)23-17(5,6)7/h8,21-22H,1-7H3 |
| InChIKey | OFFBPLKEJXNYNI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|