C13H14BF2NO4 — CID 131364457
[4,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (PubChem CID 131364457) has the molecular formula C13H14BF2NO4 and a molecular weight of 297.07 g/mol. Its IUPAC name is [4,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid.
| Compound Name | [4,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
|---|---|
| PubChem CID | 131364457 |
| Molecular Formula | C13H14BF2NO4 |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [4,5-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| SMILES | CC(C)(C)OC(=O)n1c(B(O)O)cc2c(F)c(F)ccc21 |
| InChI | InChI=1S/C13H14BF2NO4/c1-13(2,3)21-12(18)17-9-5-4-8(15)11(16)7(9)6-10(17)14(19)20/h4-6,19-20H,1-3H3 |
| InChIKey | XHGWTLSQHHEUMY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|