C21H31BN2O6 — CID 57355743
[5-[(4,4-dimethoxypiperidin-1-yl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (PubChem CID 57355743) has the molecular formula C21H31BN2O6 and a molecular weight of 418.30 g/mol. Its IUPAC name is [5-[(4,4-dimethoxypiperidin-1-yl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid.
| Compound Name | [5-[(4,4-dimethoxypiperidin-1-yl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
|---|---|
| PubChem CID | 57355743 |
| Molecular Formula | C21H31BN2O6 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | [5-[(4,4-dimethoxypiperidin-1-yl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| SMILES | COC1(OC)CCN(Cc2ccc3c(c2)cc(B(O)O)n3C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H31BN2O6/c1-20(2,3)30-19(25)24-17-7-6-15(12-16(17)13-18(24)22(26)27)14-23-10-8-21(28-4,29-5)9-11-23/h6-7,12-13,26-27H,8-11,14H2,1-5H3 |
| InChIKey | PFVDVTKMMZFCJR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|