C30H35BN2O10 — CID 160846133
1-O-tert-butyl 7-O-methyl indole-1,7-dicarboxylate;[7-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (PubChem CID 160846133) has the molecular formula C30H35BN2O10 and a molecular weight of 594.43 g/mol. Its IUPAC name is 1-O-tert-butyl 7-O-methyl indole-1,7-dicarboxylate;[7-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid.
| Compound Name | 1-O-tert-butyl 7-O-methyl indole-1,7-dicarboxylate;[7-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
|---|---|
| PubChem CID | 160846133 |
| Molecular Formula | C30H35BN2O10 |
| Molecular Weight | 594.43 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | 1-O-tert-butyl 7-O-methyl indole-1,7-dicarboxylate;[7-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| SMILES | COC(=O)c1cccc2cc(B(O)O)n(C(=O)OC(C)(C)C)c12.COC(=O)c1cccc2ccn(C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C15H18BNO6.C15H17NO4/c1-15(2,3)23-14(19)17-11(16(20)21)8-9-6-5-7-10(12(9)17)13(18)22-4;1-15(2,3)20-14(18)16-9-8-10-6-5-7-11(12(10)16)13(17)19-4/h5-8,20-21H,1-4H3;5-9H,1-4H3 |
| InChIKey | SIQZOIMEORUPRT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|