C21H30N2O5 — CID 69367584
tert-butyl 7-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]indole-1-carboxylate (PubChem CID 69367584) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl 7-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]indole-1-carboxylate.
| Compound Name | tert-butyl 7-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]indole-1-carboxylate |
|---|---|
| PubChem CID | 69367584 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | tert-butyl 7-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethoxy]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)CNCCOc1cccc2ccn(C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C21H30N2O5/c1-20(2,3)27-17(24)14-22-11-13-26-16-9-7-8-15-10-12-23(18(15)16)19(25)28-21(4,5)6/h7-10,12,22H,11,13-14H2,1-6H3 |
| InChIKey | RXJSEHGVYIRVBD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|