C16H19ClN2O4 — CID 73013562
1-O-tert-butyl 2-O-ethyl 6-chloro-5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylate (PubChem CID 73013562) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 6-chloro-5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 6-chloro-5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 73013562 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 6-chloro-5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1cc2cc(C)c(Cl)nc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19ClN2O4/c1-6-22-14(20)11-8-10-7-9(2)12(17)18-13(10)19(11)15(21)23-16(3,4)5/h7-8H,6H2,1-5H3 |
| InChIKey | YHVPLCBOGRAXEO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|